C8H11NaO5S — CID 175416212
sodium;4-ethylphenol;sulfuric acid (PubChem CID 175416212) has the molecular formula C8H11NaO5S and a molecular weight of 242.23 g/mol. Its IUPAC name is sodium;4-ethylphenol;sulfuric acid.
| Compound Name | sodium;4-ethylphenol;sulfuric acid |
|---|---|
| PubChem CID | 175416212 |
| Molecular Formula | C8H11NaO5S |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | sodium;4-ethylphenol;sulfuric acid |
| SMILES | O=S(=O)(O)O.[CH2-]Cc1ccc(O)cc1.[Na+] |
| InChI | InChI=1S/C8H9O.Na.H2O4S/c1-2-7-3-5-8(9)6-4-7;;1-5(2,3)4/h3-6,9H,1-2H2;;(H2,1,2,3,4)/q-1;+1; |
| InChIKey | LACLRDOBZWDYSY-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|