About 4-(2-aminoprop-2-enyl)phenol;carbonic acid
4-(2-aminoprop-2-enyl)phenol;carbonic acid (PubChem CID 158851238) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-(2-aminoprop-2-enyl)phenol;carbonic acid.
Molecular Properties
| Compound Name | 4-(2-aminoprop-2-enyl)phenol;carbonic acid |
| PubChem CID | 158851238 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 4-(2-aminoprop-2-enyl)phenol;carbonic acid |
| SMILES | C=C(N)Cc1ccc(O)cc1.O=C(O)O |
| InChI | InChI=1S/C9H11NO.CH2O3/c1-7(10)6-8-2-4-9(11)5-3-8;2-1(3)4/h2-5,11H,1,6,10H2;(H2,2,3,4) |
| InChIKey | IZLYRFKJZGRETO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-aminoprop-2-enyl)phenol;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoprop-2-enyl)phenol;carbonic acid?
The IUPAC name of 4-(2-aminoprop-2-enyl)phenol;carbonic acid (CID 158851238) is 4-(2-aminoprop-2-enyl)phenol;carbonic acid.
What is the SMILES notation for 4-(2-aminoprop-2-enyl)phenol;carbonic acid?
The canonical SMILES for 4-(2-aminoprop-2-enyl)phenol;carbonic acid is C=C(N)Cc1ccc(O)cc1.O=C(O)O.
What is the InChIKey of 4-(2-aminoprop-2-enyl)phenol;carbonic acid?
The InChIKey is IZLYRFKJZGRETO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.CH2O3/c1-7(10)6-8-2-4-9(11)5-3-8;2-1(3)4/h2-5,11H,1,6,10H2;(H2,2,3,4).
What are the key properties of 4-(2-aminoprop-2-enyl)phenol;carbonic acid?
4-(2-aminoprop-2-enyl)phenol;carbonic acid has a molecular weight of 211.22 g/mol, XLogP of 1.63, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoprop-2-enyl)phenol;carbonic acid is sourced from PubChem (CID 158851238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).