C20H23NO5 — CID 90856781
2-[4-[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]phenyl]acetamide (PubChem CID 90856781) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[4-[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]phenyl]acetamide.
| Compound Name | 2-[4-[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 90856781 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-[4-[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]phenyl]acetamide |
| SMILES | COCOc1ccc(C=Cc2ccc(CC(N)=O)cc2)cc1OCOC |
| InChI | InChI=1S/C20H23NO5/c1-23-13-25-18-10-9-16(11-19(18)26-14-24-2)6-3-15-4-7-17(8-5-15)12-20(21)22/h3-11H,12-14H2,1-2H3,(H2,21,22) |
| InChIKey | FUVDFXLVKRPLCG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|