C31H34O10 — CID 142209148
3,4-bis[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]benzoic acid (PubChem CID 142209148) has the molecular formula C31H34O10 and a molecular weight of 566.60 g/mol. Its IUPAC name is 3,4-bis[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]benzoic acid.
| Compound Name | 3,4-bis[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 142209148 |
| Molecular Formula | C31H34O10 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 3,4-bis[2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]benzoic acid |
| SMILES | COCOc1ccc(C=Cc2ccc(C(=O)O)cc2C=Cc2ccc(OCOC)c(OCOC)c2)cc1OCOC |
| InChI | InChI=1S/C31H34O10/c1-34-18-38-27-13-7-22(15-29(27)40-20-36-3)5-9-24-11-12-26(31(32)33)17-25(24)10-6-23-8-14-28(39-19-35-2)30(16-23)41-21-37-4/h5-17H,18-21H2,1-4H3,(H,32,33) |
| InChIKey | QBXMHPIZHLSQTP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|