C22H24O6 — CID 91216222
methyl 4-[4-[3,4-bis(methoxymethoxy)phenyl]buta-1,3-dienyl]benzoate (PubChem CID 91216222) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 4-[4-[3,4-bis(methoxymethoxy)phenyl]buta-1,3-dienyl]benzoate.
| Compound Name | methyl 4-[4-[3,4-bis(methoxymethoxy)phenyl]buta-1,3-dienyl]benzoate |
|---|---|
| PubChem CID | 91216222 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | methyl 4-[4-[3,4-bis(methoxymethoxy)phenyl]buta-1,3-dienyl]benzoate |
| SMILES | COCOc1ccc(C=CC=Cc2ccc(C(=O)OC)cc2)cc1OCOC |
| InChI | InChI=1S/C22H24O6/c1-24-15-27-20-13-10-18(14-21(20)28-16-25-2)7-5-4-6-17-8-11-19(12-9-17)22(23)26-3/h4-14H,15-16H2,1-3H3 |
| InChIKey | GPSOXEWYLRJUCH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|