C19H26O8 — CID 54184584
5-[3,4-bis(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid (PubChem CID 54184584) has the molecular formula C19H26O8 and a molecular weight of 382.41 g/mol. Its IUPAC name is 5-[3,4-bis(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid.
| Compound Name | 5-[3,4-bis(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 54184584 |
| Molecular Formula | C19H26O8 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 5-[3,4-bis(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoic acid |
| SMILES | COCCOCOc1ccc(C=CC=CC(=O)O)cc1OCOCCOC |
| InChI | InChI=1S/C19H26O8/c1-22-9-11-24-14-26-17-8-7-16(5-3-4-6-19(20)21)13-18(17)27-15-25-12-10-23-2/h3-8,13H,9-12,14-15H2,1-2H3,(H,20,21) |
| InChIKey | PEEZKYOGWKJJEY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|