C18H24O5 — CID 23046186
ethyl (2E,4E)-5-[4-(2-methoxyethoxymethoxy)-3-methylphenyl]penta-2,4-dienoate (PubChem CID 23046186) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[4-(2-methoxyethoxymethoxy)-3-methylphenyl]penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[4-(2-methoxyethoxymethoxy)-3-methylphenyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 23046186 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | ethyl (2E,4E)-5-[4-(2-methoxyethoxymethoxy)-3-methylphenyl]penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/c1ccc(OCOCCOC)c(C)c1 |
| InChI | InChI=1S/C18H24O5/c1-4-22-18(19)8-6-5-7-16-9-10-17(15(2)13-16)23-14-21-12-11-20-3/h5-10,13H,4,11-12,14H2,1-3H3/b7-5+,8-6+ |
| InChIKey | MIHUTPSXHLWIBL-KQQUZDAGSA-N |
| XLogP | 3.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|