C36H48N2O10 — CID 54488772
5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]-N-[4-[5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoylamino]butyl]penta-2,4-dienamide (PubChem CID 54488772) has the molecular formula C36H48N2O10 and a molecular weight of 668.78 g/mol. Its IUPAC name is 5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]-N-[4-[5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoylamino]butyl]penta-2,4-dienamide.
| Compound Name | 5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]-N-[4-[5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoylamino]butyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 54488772 |
| Molecular Formula | C36H48N2O10 |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | 5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]-N-[4-[5-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoylamino]butyl]penta-2,4-dienamide |
| SMILES | COCCOCOc1ccc(C=CC=CC(=O)NCCCCNC(=O)C=CC=Cc2ccc(OCOCCOC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C36H48N2O10/c1-41-21-23-45-27-47-31-17-15-29(25-33(31)43-3)11-5-7-13-35(39)37-19-9-10-20-38-36(40)14-8-6-12-30-16-18-32(34(26-30)44-4)48-28-46-24-22-42-2/h5-8,11-18,25-26H,9-10,19-24,27-28H2,1-4H3,(H,37,39)(H,38,40) |
| InChIKey | XUGPAMDRYHTUHX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|