C30H35NO6 — CID 70482910
(E)-N-(3-benzhydryloxypropyl)-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enamide (PubChem CID 70482910) has the molecular formula C30H35NO6 and a molecular weight of 505.61 g/mol. Its IUPAC name is (E)-N-(3-benzhydryloxypropyl)-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(3-benzhydryloxypropyl)-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70482910 |
| Molecular Formula | C30H35NO6 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | (E)-N-(3-benzhydryloxypropyl)-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-2-enamide |
| SMILES | COCCOCOc1ccc(/C=C/C(=O)NCCCOC(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H35NO6/c1-33-20-21-35-23-37-27-16-14-24(22-28(27)34-2)15-17-29(32)31-18-9-19-36-30(25-10-5-3-6-11-25)26-12-7-4-8-13-26/h3-8,10-17,22,30H,9,18-21,23H2,1-2H3,(H,31,32)/b17-15+ |
| InChIKey | CWEYKGCJLUDHHU-BMRADRMJSA-N |
| XLogP | 5.02 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|