C36H46N2O6 — CID 154139888
4-amino-7-(4-benzhydryloxypiperidin-1-yl)-1-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]hept-1-en-3-one (PubChem CID 154139888) has the molecular formula C36H46N2O6 and a molecular weight of 602.77 g/mol. Its IUPAC name is 4-amino-7-(4-benzhydryloxypiperidin-1-yl)-1-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]hept-1-en-3-one.
| Compound Name | 4-amino-7-(4-benzhydryloxypiperidin-1-yl)-1-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]hept-1-en-3-one |
|---|---|
| PubChem CID | 154139888 |
| Molecular Formula | C36H46N2O6 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | 4-amino-7-(4-benzhydryloxypiperidin-1-yl)-1-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]hept-1-en-3-one |
| SMILES | COCCOCOc1ccc(C=CC(=O)C(N)CCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C36H46N2O6/c1-40-24-25-42-27-43-34-18-16-28(26-35(34)41-2)15-17-33(39)32(37)14-9-21-38-22-19-31(20-23-38)44-36(29-10-5-3-6-11-29)30-12-7-4-8-13-30/h3-8,10-13,15-18,26,31-32,36H,9,14,19-25,27,37H2,1-2H3 |
| InChIKey | UQMOWJAWLMIYTB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|