C30H35NO7 — CID 70484056
4-amino-5-benzhydryloxy-1-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]pent-1-en-3-one (PubChem CID 70484056) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is 4-amino-5-benzhydryloxy-1-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]pent-1-en-3-one.
| Compound Name | 4-amino-5-benzhydryloxy-1-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]pent-1-en-3-one |
|---|---|
| PubChem CID | 70484056 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 4-amino-5-benzhydryloxy-1-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]pent-1-en-3-one |
| SMILES | COCCOCOc1c(OC)cc(C=CC(=O)C(N)COC(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C30H35NO7/c1-33-16-17-36-21-38-30-27(34-2)18-22(19-28(30)35-3)14-15-26(32)25(31)20-37-29(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-15,18-19,25,29H,16-17,20-21,31H2,1-3H3 |
| InChIKey | YCAJJTDKYQQQJH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|