C20H21NO6 — CID 67078911
4-[(E)-1-amino-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enyl]benzoic acid (PubChem CID 67078911) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-[(E)-1-amino-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enyl]benzoic acid.
| Compound Name | 4-[(E)-1-amino-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enyl]benzoic acid |
|---|---|
| PubChem CID | 67078911 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-[(E)-1-amino-2-oxo-4-(3,4,5-trimethoxyphenyl)but-3-enyl]benzoic acid |
| SMILES | COc1cc(/C=C/C(=O)C(N)c2ccc(C(=O)O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21NO6/c1-25-16-10-12(11-17(26-2)19(16)27-3)4-9-15(22)18(21)13-5-7-14(8-6-13)20(23)24/h4-11,18H,21H2,1-3H3,(H,23,24)/b9-4+ |
| InChIKey | MJHIFKHSLOSWTD-RUDMXATFSA-N |
| XLogP | 2.69 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|