C22H25NO6 — CID 3344409
propan-2-yl 4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzoate (PubChem CID 3344409) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is propan-2-yl 4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzoate.
| Compound Name | propan-2-yl 4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 3344409 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | propan-2-yl 4-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzoate |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(C(=O)OC(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25NO6/c1-14(2)29-22(25)16-7-9-17(10-8-16)23-20(24)11-6-15-12-18(26-3)21(28-5)19(13-15)27-4/h6-14H,1-5H3,(H,23,24) |
| InChIKey | SEXUTAOGSARNAW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|