C20H20BrNO5 — CID 4682748
ethyl 4-[3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoylamino]benzoate (PubChem CID 4682748) has the molecular formula C20H20BrNO5 and a molecular weight of 434.29 g/mol. Its IUPAC name is ethyl 4-[3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoylamino]benzoate.
| Compound Name | ethyl 4-[3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 4682748 |
| Molecular Formula | C20H20BrNO5 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | ethyl 4-[3-(3-bromo-4,5-dimethoxyphenyl)prop-2-enoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C=Cc2cc(Br)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H20BrNO5/c1-4-27-20(24)14-6-8-15(9-7-14)22-18(23)10-5-13-11-16(21)19(26-3)17(12-13)25-2/h5-12H,4H2,1-3H3,(H,22,23) |
| InChIKey | MCFWINZAYXKOQB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|