C17H24O8 — CID 54539611
3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-2-(methoxymethyl)prop-2-enoic acid (PubChem CID 54539611) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is 3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-2-(methoxymethyl)prop-2-enoic acid.
| Compound Name | 3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-2-(methoxymethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54539611 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-2-(methoxymethyl)prop-2-enoic acid |
| SMILES | COCCOCOc1c(OC)cc(C=C(COC)C(=O)O)cc1OC |
| InChI | InChI=1S/C17H24O8/c1-20-5-6-24-11-25-16-14(22-3)8-12(9-15(16)23-4)7-13(10-21-2)17(18)19/h7-9H,5-6,10-11H2,1-4H3,(H,18,19) |
| InChIKey | ZCFLPVHSXMPROW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|