C24H27NO8 — CID 54120167
2-[5-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoylamino]benzoic acid (PubChem CID 54120167) has the molecular formula C24H27NO8 and a molecular weight of 457.48 g/mol. Its IUPAC name is 2-[5-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoylamino]benzoic acid.
| Compound Name | 2-[5-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoylamino]benzoic acid |
|---|---|
| PubChem CID | 54120167 |
| Molecular Formula | C24H27NO8 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 2-[5-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]penta-2,4-dienoylamino]benzoic acid |
| SMILES | COCCOCOc1c(OC)cc(C=CC=CC(=O)Nc2ccccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C24H27NO8/c1-29-12-13-32-16-33-23-20(30-2)14-17(15-21(23)31-3)8-4-7-11-22(26)25-19-10-6-5-9-18(19)24(27)28/h4-11,14-15H,12-13,16H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | NNCSOKMGWZYQRE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|