C22H25N3O6 — CID 56516538
N-(3-amino-3-oxopropyl)-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide (PubChem CID 56516538) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-(3-amino-3-oxopropyl)-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 56516538 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2C(=O)NCCC(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H25N3O6/c1-29-17-12-14(13-18(30-2)21(17)31-3)8-9-20(27)25-16-7-5-4-6-15(16)22(28)24-11-10-19(23)26/h4-9,12-13H,10-11H2,1-3H3,(H2,23,26)(H,24,28)(H,25,27)/b9-8+ |
| InChIKey | XJRPVOKOIUYLEA-CMDGGOBGSA-N |
| XLogP | 1.97 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|