C23H28N2O7 — CID 67648342
N-[2-(2-hydroxyethoxy)ethyl]-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide (PubChem CID 67648342) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 67648342 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]benzamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2C(=O)NCCOCCO)cc(OC)c1OC |
| InChI | InChI=1S/C23H28N2O7/c1-29-19-14-16(15-20(30-2)22(19)31-3)8-9-21(27)25-18-7-5-4-6-17(18)23(28)24-10-12-32-13-11-26/h4-9,14-15,26H,10-13H2,1-3H3,(H,24,28)(H,25,27)/b9-8+ |
| InChIKey | RMCBWSJFLFOGEC-CMDGGOBGSA-N |
| XLogP | 2.10 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|