C35H36N2O10 — CID 18518185
3,5-bis[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]benzoic acid (PubChem CID 18518185) has the molecular formula C35H36N2O10 and a molecular weight of 644.68 g/mol. Its IUPAC name is 3,5-bis[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]benzoic acid.
| Compound Name | 3,5-bis[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18518185 |
| Molecular Formula | C35H36N2O10 |
| Molecular Weight | 644.68 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | 3,5-bis[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]benzoic acid |
| SMILES | COc1cc(/C=C/C=C/C(=O)Nc2cc(NC(=O)/C=C/C=C/c3cc(OC)c(OC)c(OC)c3)cc(C(=O)O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C35H36N2O10/c1-42-27-15-22(16-28(43-2)33(27)46-5)11-7-9-13-31(38)36-25-19-24(35(40)41)20-26(21-25)37-32(39)14-10-8-12-23-17-29(44-3)34(47-6)30(18-23)45-4/h7-21H,1-6H3,(H,36,38)(H,37,39)(H,40,41)/b11-7+,12-8+,13-9+,14-10+ |
| InChIKey | KUIZQGNJUMZUNC-DQVHGGFXSA-N |
| XLogP | 5.85 |
| TPSA | 150.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|