C36H38N2O9 — CID 89245898
methyl 3-[[(2E,4E)-5-(3,5-dimethoxy-4-methylphenyl)penta-2,4-dienoyl]amino]-5-[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]benzoate (PubChem CID 89245898) has the molecular formula C36H38N2O9 and a molecular weight of 642.71 g/mol. Its IUPAC name is methyl 3-[[(2E,4E)-5-(3,5-dimethoxy-4-methylphenyl)penta-2,4-dienoyl]amino]-5-[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]benzoate.
| Compound Name | methyl 3-[[(2E,4E)-5-(3,5-dimethoxy-4-methylphenyl)penta-2,4-dienoyl]amino]-5-[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]benzoate |
|---|---|
| PubChem CID | 89245898 |
| Molecular Formula | C36H38N2O9 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.26 |
| IUPAC Name | methyl 3-[[(2E,4E)-5-(3,5-dimethoxy-4-methylphenyl)penta-2,4-dienoyl]amino]-5-[[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)/C=C/C=C/c2cc(OC)c(C)c(OC)c2)cc(NC(=O)/C=C/C=C/c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C36H38N2O9/c1-23-29(42-2)16-24(17-30(23)43-3)12-8-10-14-33(39)37-27-20-26(36(41)47-7)21-28(22-27)38-34(40)15-11-9-13-25-18-31(44-4)35(46-6)32(19-25)45-5/h8-22H,1-7H3,(H,37,39)(H,38,40)/b12-8+,13-9+,14-10+,15-11+ |
| InChIKey | RRGIJUPWOLRWLQ-IBLHVVBDSA-N |
| XLogP | 6.24 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|