C18H21NO6S2 — CID 54242735
3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-1-(2-sulfanylidene-1,3-thiazol-3-yl)prop-2-en-1-one (PubChem CID 54242735) has the molecular formula C18H21NO6S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is 3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-1-(2-sulfanylidene-1,3-thiazol-3-yl)prop-2-en-1-one.
| Compound Name | 3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-1-(2-sulfanylidene-1,3-thiazol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54242735 |
| Molecular Formula | C18H21NO6S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-1-(2-sulfanylidene-1,3-thiazol-3-yl)prop-2-en-1-one |
| SMILES | COCCOCOc1c(OC)cc(C=CC(=O)n2ccsc2=S)cc1OC |
| InChI | InChI=1S/C18H21NO6S2/c1-21-7-8-24-12-25-17-14(22-2)10-13(11-15(17)23-3)4-5-16(20)19-6-9-27-18(19)26/h4-6,9-11H,7-8,12H2,1-3H3 |
| InChIKey | QRDLCUIKKZVJRC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|