C28H38N2O7 — CID 70431421
3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-1-[4-(3-hydroxy-3-phenylpropyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 70431421) has the molecular formula C28H38N2O7 and a molecular weight of 514.62 g/mol. Its IUPAC name is 3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-1-[4-(3-hydroxy-3-phenylpropyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-1-[4-(3-hydroxy-3-phenylpropyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70431421 |
| Molecular Formula | C28H38N2O7 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 3-[3,5-dimethoxy-4-(2-methoxyethoxymethoxy)phenyl]-1-[4-(3-hydroxy-3-phenylpropyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COCCOCOc1c(OC)cc(C=CC(=O)N2CCN(CCC(O)c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C28H38N2O7/c1-33-17-18-36-21-37-28-25(34-2)19-22(20-26(28)35-3)9-10-27(32)30-15-13-29(14-16-30)12-11-24(31)23-7-5-4-6-8-23/h4-10,19-20,24,31H,11-18,21H2,1-3H3 |
| InChIKey | RNTUWZDHBGTKLH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|