C23H28N2O5 — CID 70431428
3-(4-hydroxy-3,5-dimethoxyphenyl)-1-[4-(2-hydroxy-2-phenylethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 70431428) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)-1-[4-(2-hydroxy-2-phenylethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-1-[4-(2-hydroxy-2-phenylethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70431428 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-1-[4-(2-hydroxy-2-phenylethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)N2CCN(CC(O)c3ccccc3)CC2)cc(OC)c1O |
| InChI | InChI=1S/C23H28N2O5/c1-29-20-14-17(15-21(30-2)23(20)28)8-9-22(27)25-12-10-24(11-13-25)16-19(26)18-6-4-3-5-7-18/h3-9,14-15,19,26,28H,10-13,16H2,1-2H3 |
| InChIKey | MQUYFWABNPCLGH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|