C30H42N2O6 — CID 10346793
(E)-3-(3,5-dibutoxy-4-hydroxyphenyl)-1-[4-[2-hydroxy-2-(4-methoxyphenyl)ethyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 10346793) has the molecular formula C30H42N2O6 and a molecular weight of 526.67 g/mol. Its IUPAC name is (E)-3-(3,5-dibutoxy-4-hydroxyphenyl)-1-[4-[2-hydroxy-2-(4-methoxyphenyl)ethyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dibutoxy-4-hydroxyphenyl)-1-[4-[2-hydroxy-2-(4-methoxyphenyl)ethyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10346793 |
| Molecular Formula | C30H42N2O6 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | (E)-3-(3,5-dibutoxy-4-hydroxyphenyl)-1-[4-[2-hydroxy-2-(4-methoxyphenyl)ethyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCCCOc1cc(/C=C/C(=O)N2CCN(CC(O)c3ccc(OC)cc3)CC2)cc(OCCCC)c1O |
| InChI | InChI=1S/C30H42N2O6/c1-4-6-18-37-27-20-23(21-28(30(27)35)38-19-7-5-2)8-13-29(34)32-16-14-31(15-17-32)22-26(33)24-9-11-25(36-3)12-10-24/h8-13,20-21,26,33,35H,4-7,14-19,22H2,1-3H3/b13-8+ |
| InChIKey | VBTMOEVOKBRKSJ-MDWZMJQESA-N |
| XLogP | 4.65 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|