C19H26FNO5S — CID 166409046
1-[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]piperidine-4-sulfonyl fluoride (PubChem CID 166409046) has the molecular formula C19H26FNO5S and a molecular weight of 399.48 g/mol. Its IUPAC name is 1-[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]piperidine-4-sulfonyl fluoride.
| Compound Name | 1-[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]piperidine-4-sulfonyl fluoride |
|---|---|
| PubChem CID | 166409046 |
| Molecular Formula | C19H26FNO5S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]piperidine-4-sulfonyl fluoride |
| SMILES | CCCCOc1ccc(/C=C/C(=O)N2CCC(S(=O)(=O)F)CC2)cc1OC |
| InChI | InChI=1S/C19H26FNO5S/c1-3-4-13-26-17-7-5-15(14-18(17)25-2)6-8-19(22)21-11-9-16(10-12-21)27(20,23)24/h5-8,14,16H,3-4,9-13H2,1-2H3/b8-6+ |
| InChIKey | GTWYQFNZNXJWEI-SOFGYWHQSA-N |
| XLogP | 3.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|