C19H26O10 — CID 70233093
2-[[3,5-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylidene]butanoic acid (PubChem CID 70233093) has the molecular formula C19H26O10 and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-[[3,5-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylidene]butanoic acid.
| Compound Name | 2-[[3,5-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 70233093 |
| Molecular Formula | C19H26O10 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[[3,5-dimethoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methylidene]butanoic acid |
| SMILES | CCC(=Cc1cc(OC)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C19H26O10/c1-4-10(18(24)25)5-9-6-11(26-2)17(12(7-9)27-3)29-19-16(23)15(22)14(21)13(8-20)28-19/h5-7,13-16,19-23H,4,8H2,1-3H3,(H,24,25)/t13-,14-,15+,16-,19+/m1/s1 |
| InChIKey | PWGSHPNVQHSEQI-FDQIELQPSA-N |
| XLogP | -0.24 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|