C39H42N2O4 — CID 154479433
2-amino-1-(4-benzhydryloxypiperidin-1-yl)-7-(3-methoxy-4-phenylmethoxyphenyl)hepta-4,6-dien-3-one (PubChem CID 154479433) has the molecular formula C39H42N2O4 and a molecular weight of 602.78 g/mol. Its IUPAC name is 2-amino-1-(4-benzhydryloxypiperidin-1-yl)-7-(3-methoxy-4-phenylmethoxyphenyl)hepta-4,6-dien-3-one.
| Compound Name | 2-amino-1-(4-benzhydryloxypiperidin-1-yl)-7-(3-methoxy-4-phenylmethoxyphenyl)hepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 154479433 |
| Molecular Formula | C39H42N2O4 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 2-amino-1-(4-benzhydryloxypiperidin-1-yl)-7-(3-methoxy-4-phenylmethoxyphenyl)hepta-4,6-dien-3-one |
| SMILES | COc1cc(C=CC=CC(=O)C(N)CN2CCC(OC(c3ccccc3)c3ccccc3)CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C39H42N2O4/c1-43-38-27-30(21-22-37(38)44-29-31-14-5-2-6-15-31)13-11-12-20-36(42)35(40)28-41-25-23-34(24-26-41)45-39(32-16-7-3-8-17-32)33-18-9-4-10-19-33/h2-22,27,34-35,39H,23-26,28-29,40H2,1H3 |
| InChIKey | YSSCEFHMTLVRSA-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|