About (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid
(2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid (PubChem CID 19888946) has the molecular formula C15H16O6
and a molecular weight of 292.28 g/mol. Its IUPAC name is (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid.
Molecular Properties
| Compound Name | (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid |
| PubChem CID | 19888946 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid |
| SMILES | CCOC(=O)OC1=C(C=C(C=C1)/C=C/C=C/C(=O)O)OC |
| InChI | InChI=1S/C15H16O6/c1-3-20-15(18)21-12-9-8-11(10-13(12)19-2)6-4-5-7-14(16)17/h4-10H,3H2,1-2H3,(H,16,17)/b6-4+,7-5+ |
| InChIKey | YZFSFOBZEKQPNE-YDFGWWAZSA-N |
| XLogP | 3.00 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | 401 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid?
The IUPAC name of (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid (CID 19888946) is (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid.
What is the SMILES notation for (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid?
The canonical SMILES for (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid is CCOC(=O)OC1=C(C=C(C=C1)/C=C/C=C/C(=O)O)OC.
What is the InChIKey of (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid?
The InChIKey is YZFSFOBZEKQPNE-YDFGWWAZSA-N. The full InChI is InChI=1S/C15H16O6/c1-3-20-15(18)21-12-9-8-11(10-13(12)19-2)6-4-5-7-14(16)17/h4-10H,3H2,1-2H3,(H,16,17)/b6-4+,7-5+.
What are the key properties of (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid?
(2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid has a molecular weight of 292.28 g/mol, XLogP of 3.00, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-5-(4-ethoxycarbonyloxy-3-methoxyphenyl)penta-2,4-dienoic acid is sourced from PubChem (CID 19888946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).