C14H16O5Y — CID 58284179
(E)-3-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]prop-2-enoic acid;yttrium (PubChem CID 58284179) has the molecular formula C14H16O5Y and a molecular weight of 353.18 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]prop-2-enoic acid;yttrium.
| Compound Name | (E)-3-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]prop-2-enoic acid;yttrium |
|---|---|
| PubChem CID | 58284179 |
| Molecular Formula | C14H16O5Y |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | (E)-3-[3-methoxy-4-(2-methylpropanoyloxy)phenyl]prop-2-enoic acid;yttrium |
| SMILES | COc1cc(/C=C/C(=O)O)ccc1OC(=O)C(C)C.[Y] |
| InChI | InChI=1S/C14H16O5.Y/c1-9(2)14(17)19-11-6-4-10(5-7-13(15)16)8-12(11)18-3;/h4-9H,1-3H3,(H,15,16);/b7-5+; |
| InChIKey | NGNCSFSMCCALEM-GZOLSCHFSA-N |
| XLogP | 2.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|