C39H49ClN2O8 — CID 54470719
5-[3,4-bis(2-methoxyethoxymethoxy)phenyl]-1-[4-[2-[1-(4-chlorophenyl)-1-phenylethoxy]ethyl]piperazin-1-yl]penta-2,4-dien-1-one (PubChem CID 54470719) has the molecular formula C39H49ClN2O8 and a molecular weight of 709.28 g/mol. Its IUPAC name is 5-[3,4-bis(2-methoxyethoxymethoxy)phenyl]-1-[4-[2-[1-(4-chlorophenyl)-1-phenylethoxy]ethyl]piperazin-1-yl]penta-2,4-dien-1-one.
| Compound Name | 5-[3,4-bis(2-methoxyethoxymethoxy)phenyl]-1-[4-[2-[1-(4-chlorophenyl)-1-phenylethoxy]ethyl]piperazin-1-yl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 54470719 |
| Molecular Formula | C39H49ClN2O8 |
| Molecular Weight | 709.28 g/mol |
| Exact Mass | 708.32 |
| IUPAC Name | 5-[3,4-bis(2-methoxyethoxymethoxy)phenyl]-1-[4-[2-[1-(4-chlorophenyl)-1-phenylethoxy]ethyl]piperazin-1-yl]penta-2,4-dien-1-one |
| SMILES | COCCOCOc1ccc(C=CC=CC(=O)N2CCN(CCOC(C)(c3ccccc3)c3ccc(Cl)cc3)CC2)cc1OCOCCOC |
| InChI | InChI=1S/C39H49ClN2O8/c1-39(33-10-5-4-6-11-33,34-14-16-35(40)17-15-34)50-24-23-41-19-21-42(22-20-41)38(43)12-8-7-9-32-13-18-36(48-30-46-27-25-44-2)37(29-32)49-31-47-28-26-45-3/h4-18,29H,19-28,30-31H2,1-3H3 |
| InChIKey | XIDRDGUYHLEHFM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 88.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.28 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|