C28H28Cl2N2O3 — CID 19295263
(E)-1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-en-1-one (PubChem CID 19295263) has the molecular formula C28H28Cl2N2O3 and a molecular weight of 511.45 g/mol. Its IUPAC name is (E)-1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19295263 |
| Molecular Formula | C28H28Cl2N2O3 |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | (E)-1-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-3-[4-methoxy-3-(phenoxymethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCN(Cc3ccc(Cl)cc3Cl)CC2)cc1COc1ccccc1 |
| InChI | InChI=1S/C28H28Cl2N2O3/c1-34-27-11-7-21(17-23(27)20-35-25-5-3-2-4-6-25)8-12-28(33)32-15-13-31(14-16-32)19-22-9-10-24(29)18-26(22)30/h2-12,17-18H,13-16,19-20H2,1H3/b12-8+ |
| InChIKey | CQVMDYZCKJLLQH-XYOKQWHBSA-N |
| XLogP | 5.94 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|