C26H23Cl2FN2O2 — CID 6277878
(E)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 6277878) has the molecular formula C26H23Cl2FN2O2 and a molecular weight of 485.39 g/mol. Its IUPAC name is (E)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6277878 |
| Molecular Formula | C26H23Cl2FN2O2 |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | (E)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-1-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OCc2ccc(Cl)cc2Cl)cc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H23Cl2FN2O2/c27-21-9-8-20(23(28)17-21)18-33-22-10-5-19(6-11-22)7-12-26(32)31-15-13-30(14-16-31)25-4-2-1-3-24(25)29/h1-12,17H,13-16,18H2/b12-7+ |
| InChIKey | CNWHYWJKSCCGSW-KPKJPENVSA-N |
| XLogP | 6.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|