C28H28Cl2N2O2 — CID 176945307
(E)-1-[4-[2-[bis(4-chlorophenyl)methoxy]ethyl]piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 176945307) has the molecular formula C28H28Cl2N2O2 and a molecular weight of 495.45 g/mol. Its IUPAC name is (E)-1-[4-[2-[bis(4-chlorophenyl)methoxy]ethyl]piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-[bis(4-chlorophenyl)methoxy]ethyl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 176945307 |
| Molecular Formula | C28H28Cl2N2O2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (E)-1-[4-[2-[bis(4-chlorophenyl)methoxy]ethyl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCN(CCOC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C28H28Cl2N2O2/c29-25-11-7-23(8-12-25)28(24-9-13-26(30)14-10-24)34-21-20-31-16-18-32(19-17-31)27(33)15-6-22-4-2-1-3-5-22/h1-15,28H,16-21H2/b15-6+ |
| InChIKey | ZKHWBRWSFRIHCY-GIDUJCDVSA-N |
| XLogP | 5.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|