C28H32Cl2N2O — CID 176945327
1-[2-[bis(4-chlorophenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine (PubChem CID 176945327) has the molecular formula C28H32Cl2N2O and a molecular weight of 483.48 g/mol. Its IUPAC name is 1-[2-[bis(4-chlorophenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine.
| Compound Name | 1-[2-[bis(4-chlorophenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine |
|---|---|
| PubChem CID | 176945327 |
| Molecular Formula | C28H32Cl2N2O |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 1-[2-[bis(4-chlorophenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine |
| SMILES | Clc1ccc(C(OCCN2CCN(CCCc3ccccc3)CC2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H32Cl2N2O/c29-26-12-8-24(9-13-26)28(25-10-14-27(30)15-11-25)33-22-21-32-19-17-31(18-20-32)16-4-7-23-5-2-1-3-6-23/h1-3,5-6,8-15,28H,4,7,16-22H2 |
| InChIKey | XHLGKXUTHAIDTG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |