C28H34F2N2O5S — CID 10239703
1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine;sulfuric acid (PubChem CID 10239703) has the molecular formula C28H34F2N2O5S and a molecular weight of 548.65 g/mol. Its IUPAC name is 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine;sulfuric acid.
| Compound Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine;sulfuric acid |
|---|---|
| PubChem CID | 10239703 |
| Molecular Formula | C28H34F2N2O5S |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine;sulfuric acid |
| SMILES | Fc1ccc(C(OCCN2CCN(CCCc3ccccc3)CC2)c2ccc(F)cc2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C28H32F2N2O.H2O4S/c29-26-12-8-24(9-13-26)28(25-10-14-27(30)15-11-25)33-22-21-32-19-17-31(18-20-32)16-4-7-23-5-2-1-3-6-23;1-5(2,3)4/h1-3,5-6,8-15,28H,4,7,16-22H2;(H2,1,2,3,4) |
| InChIKey | MZVURUSMWRFGFG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|