C30H32F2N2O5 — CID 70573507
1-benzyl-4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazine;but-2-enedioic acid (PubChem CID 70573507) has the molecular formula C30H32F2N2O5 and a molecular weight of 538.59 g/mol. Its IUPAC name is 1-benzyl-4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazine;but-2-enedioic acid.
| Compound Name | 1-benzyl-4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazine;but-2-enedioic acid |
|---|---|
| PubChem CID | 70573507 |
| Molecular Formula | C30H32F2N2O5 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 1-benzyl-4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazine;but-2-enedioic acid |
| SMILES | Fc1ccc(C(OCCN2CCN(Cc3ccccc3)CC2)c2ccc(F)cc2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C26H28F2N2O.C4H4O4/c27-24-10-6-22(7-11-24)26(23-8-12-25(28)13-9-23)31-19-18-29-14-16-30(17-15-29)20-21-4-2-1-3-5-21;5-3(6)1-2-4(7)8/h1-13,26H,14-20H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | FVAGACSNXAKUBF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|