C27H27F2NO5 — CID 20839307
N-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2-phenylethanamine;(Z)-but-2-enedioic acid (PubChem CID 20839307) has the molecular formula C27H27F2NO5 and a molecular weight of 483.51 g/mol. Its IUPAC name is N-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2-phenylethanamine;(Z)-but-2-enedioic acid.
| Compound Name | N-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2-phenylethanamine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 20839307 |
| Molecular Formula | C27H27F2NO5 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | N-[2-[bis(4-fluorophenyl)methoxy]ethyl]-2-phenylethanamine;(Z)-but-2-enedioic acid |
| SMILES | Fc1ccc(C(OCCNCCc2ccccc2)c2ccc(F)cc2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C23H23F2NO.C4H4O4/c24-21-10-6-19(7-11-21)23(20-8-12-22(25)13-9-20)27-17-16-26-15-14-18-4-2-1-3-5-18;5-3(6)1-2-4(7)8/h1-13,23,26H,14-17H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | KJUUHDZHJMNDRA-BTJKTKAUSA-N |
| XLogP | 4.61 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|