C29H30F2N2O3 — CID 10719928
(E)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 10719928) has the molecular formula C29H30F2N2O3 and a molecular weight of 492.57 g/mol. Its IUPAC name is (E)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10719928 |
| Molecular Formula | C29H30F2N2O3 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (E)-1-[4-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1/C=C/C(=O)N1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H30F2N2O3/c1-35-27-5-3-2-4-22(27)10-15-28(34)33-18-16-32(17-19-33)20-21-36-29(23-6-11-25(30)12-7-23)24-8-13-26(31)14-9-24/h2-15,29H,16-21H2,1H3/b15-10+ |
| InChIKey | WNLVCHALYXWYNH-XNTDXEJSSA-N |
| XLogP | 4.94 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|