C33H41ClN2O9 — CID 6436584
bis((Z)-but-2-enedioic acid);1-[2-[(4-chlorophenyl)-phenylmethoxy]ethyl]-4-cyclohexylpiperazine (PubChem CID 6436584) has the molecular formula C33H41ClN2O9 and a molecular weight of 645.15 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);1-[2-[(4-chlorophenyl)-phenylmethoxy]ethyl]-4-cyclohexylpiperazine.
| Compound Name | bis((Z)-but-2-enedioic acid);1-[2-[(4-chlorophenyl)-phenylmethoxy]ethyl]-4-cyclohexylpiperazine |
|---|---|
| PubChem CID | 6436584 |
| Molecular Formula | C33H41ClN2O9 |
| Molecular Weight | 645.15 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);1-[2-[(4-chlorophenyl)-phenylmethoxy]ethyl]-4-cyclohexylpiperazine |
| SMILES | Clc1ccc(C(OCCN2CCN(C3CCCCC3)CC2)c2ccccc2)cc1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H33ClN2O.2C4H4O4/c26-23-13-11-22(12-14-23)25(21-7-3-1-4-8-21)29-20-19-27-15-17-28(18-16-27)24-9-5-2-6-10-24;2*5-3(6)1-2-4(7)8/h1,3-4,7-8,11-14,24-25H,2,5-6,9-10,15-20H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | CFEADHDMYFAQIZ-SPIKMXEPSA-N |
| XLogP | 4.82 |
| TPSA | 164.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.15 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|