C34H37ClN2O8 — CID 6436573
1-benzyl-4-[3-(4-chlorophenyl)-3-phenylpropyl]piperazine;bis((Z)-but-2-enedioic acid) (PubChem CID 6436573) has the molecular formula C34H37ClN2O8 and a molecular weight of 637.13 g/mol. Its IUPAC name is 1-benzyl-4-[3-(4-chlorophenyl)-3-phenylpropyl]piperazine;bis((Z)-but-2-enedioic acid).
| Compound Name | 1-benzyl-4-[3-(4-chlorophenyl)-3-phenylpropyl]piperazine;bis((Z)-but-2-enedioic acid) |
|---|---|
| PubChem CID | 6436573 |
| Molecular Formula | C34H37ClN2O8 |
| Molecular Weight | 637.13 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | 1-benzyl-4-[3-(4-chlorophenyl)-3-phenylpropyl]piperazine;bis((Z)-but-2-enedioic acid) |
| SMILES | Clc1ccc(C(CCN2CCN(Cc3ccccc3)CC2)c2ccccc2)cc1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C26H29ClN2.2C4H4O4/c27-25-13-11-24(12-14-25)26(23-9-5-2-6-10-23)15-16-28-17-19-29(20-18-28)21-22-7-3-1-4-8-22;2*5-3(6)1-2-4(7)8/h1-14,26H,15-21H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | HXKZYDGLXUAIRN-SPIKMXEPSA-N |
| XLogP | 5.10 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.13 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|