C28H38O10 — CID 68981232
methyl 4-[(E)-2-[3,4-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]ethenyl]benzoate (PubChem CID 68981232) has the molecular formula C28H38O10 and a molecular weight of 534.60 g/mol. Its IUPAC name is methyl 4-[(E)-2-[3,4-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]ethenyl]benzoate.
| Compound Name | methyl 4-[(E)-2-[3,4-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 68981232 |
| Molecular Formula | C28H38O10 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | methyl 4-[(E)-2-[3,4-bis[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/c2ccc(OCCOCCOCCO)c(OCCOCCOCCO)c2)cc1 |
| InChI | InChI=1S/C28H38O10/c1-32-28(31)25-7-4-23(5-8-25)2-3-24-6-9-26(37-20-18-35-16-14-33-12-10-29)27(22-24)38-21-19-36-17-15-34-13-11-30/h2-9,22,29-30H,10-21H2,1H3/b3-2+ |
| InChIKey | CNRSONAYJXDQPJ-NSCUHMNNSA-N |
| XLogP | 2.45 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|