C18H29NO7 — CID 14942293
3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4-(methylamino)benzaldehyde (PubChem CID 14942293) has the molecular formula C18H29NO7 and a molecular weight of 371.43 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4-(methylamino)benzaldehyde.
| Compound Name | 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4-(methylamino)benzaldehyde |
|---|---|
| PubChem CID | 14942293 |
| Molecular Formula | C18H29NO7 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-4-(methylamino)benzaldehyde |
| SMILES | CNc1ccc(C=O)cc1OCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C18H29NO7/c1-19-17-3-2-16(15-21)14-18(17)26-13-12-25-11-10-24-9-8-23-7-6-22-5-4-20/h2-3,14-15,19-20H,4-13H2,1H3 |
| InChIKey | QKADCKOEIYZKLN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|