C13H18O4 — CID 61071247
4-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethylbenzaldehyde (PubChem CID 61071247) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethylbenzaldehyde.
| Compound Name | 4-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 61071247 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethylbenzaldehyde |
| SMILES | Cc1cc(C=O)cc(C)c1OCCOCCO |
| InChI | InChI=1S/C13H18O4/c1-10-7-12(9-15)8-11(2)13(10)17-6-5-16-4-3-14/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | GRJDEPDCAZWLEZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|