C14H20O3 — CID 106453020
3,5-dimethyl-4-(2-propoxyethoxy)benzaldehyde (PubChem CID 106453020) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 3,5-dimethyl-4-(2-propoxyethoxy)benzaldehyde.
| Compound Name | 3,5-dimethyl-4-(2-propoxyethoxy)benzaldehyde |
|---|---|
| PubChem CID | 106453020 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3,5-dimethyl-4-(2-propoxyethoxy)benzaldehyde |
| SMILES | CCCOCCOc1c(C)cc(C=O)cc1C |
| InChI | InChI=1S/C14H20O3/c1-4-5-16-6-7-17-14-11(2)8-13(10-15)9-12(14)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | BXXNYYIKWYJPKD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|