C13H18O4S — CID 43807824
4-(2-ethylsulfonylethoxy)-3,5-dimethylbenzaldehyde (PubChem CID 43807824) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-(2-ethylsulfonylethoxy)-3,5-dimethylbenzaldehyde.
| Compound Name | 4-(2-ethylsulfonylethoxy)-3,5-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 43807824 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-(2-ethylsulfonylethoxy)-3,5-dimethylbenzaldehyde |
| SMILES | CCS(=O)(=O)CCOc1c(C)cc(C=O)cc1C |
| InChI | InChI=1S/C13H18O4S/c1-4-18(15,16)6-5-17-13-10(2)7-12(9-14)8-11(13)3/h7-9H,4-6H2,1-3H3 |
| InChIKey | GDWWCGHUYAQMQI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|