C12H19NO3 — CID 11845008
2-[2-(4-amino-2,6-dimethylphenoxy)ethoxy]ethanol (PubChem CID 11845008) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-[2-(4-amino-2,6-dimethylphenoxy)ethoxy]ethanol.
| Compound Name | 2-[2-(4-amino-2,6-dimethylphenoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 11845008 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2-[2-(4-amino-2,6-dimethylphenoxy)ethoxy]ethanol |
| SMILES | Cc1cc(N)cc(C)c1OCCOCCO |
| InChI | InChI=1S/C12H19NO3/c1-9-7-11(13)8-10(2)12(9)16-6-5-15-4-3-14/h7-8,14H,3-6,13H2,1-2H3 |
| InChIKey | QDWBIFSSXGDOQJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|