C18H24O8 — CID 25146352
7,8-bis[2-(2-hydroxyethoxy)ethoxy]-4-methylchromen-2-one (PubChem CID 25146352) has the molecular formula C18H24O8 and a molecular weight of 368.38 g/mol. Its IUPAC name is 7,8-bis[2-(2-hydroxyethoxy)ethoxy]-4-methylchromen-2-one.
| Compound Name | 7,8-bis[2-(2-hydroxyethoxy)ethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 25146352 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 7,8-bis[2-(2-hydroxyethoxy)ethoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2c(OCCOCCO)c(OCCOCCO)ccc12 |
| InChI | InChI=1S/C18H24O8/c1-13-12-16(21)26-17-14(13)2-3-15(24-10-8-22-6-4-19)18(17)25-11-9-23-7-5-20/h2-3,12,19-20H,4-11H2,1H3 |
| InChIKey | UHZVEWLGKQJVRN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|