C10H10O10P2 — CID 56839869
(4-methyl-2-oxo-7-phosphonooxychromen-8-yl) dihydrogen phosphate (PubChem CID 56839869) has the molecular formula C10H10O10P2 and a molecular weight of 352.13 g/mol. Its IUPAC name is (4-methyl-2-oxo-7-phosphonooxychromen-8-yl) dihydrogen phosphate.
| Compound Name | (4-methyl-2-oxo-7-phosphonooxychromen-8-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 56839869 |
| Molecular Formula | C10H10O10P2 |
| Molecular Weight | 352.13 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | (4-methyl-2-oxo-7-phosphonooxychromen-8-yl) dihydrogen phosphate |
| SMILES | Cc1cc(=O)oc2c(OP(=O)(O)O)c(OP(=O)(O)O)ccc12 |
| InChI | InChI=1S/C10H10O10P2/c1-5-4-8(11)18-9-6(5)2-3-7(19-21(12,13)14)10(9)20-22(15,16)17/h2-4H,1H3,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | RIJAOPGNLZWGLC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.13 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|