C11H11O6P — CID 56839646
(4,8-dimethyl-2-oxochromen-7-yl) dihydrogen phosphate (PubChem CID 56839646) has the molecular formula C11H11O6P and a molecular weight of 270.18 g/mol. Its IUPAC name is (4,8-dimethyl-2-oxochromen-7-yl) dihydrogen phosphate.
| Compound Name | (4,8-dimethyl-2-oxochromen-7-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 56839646 |
| Molecular Formula | C11H11O6P |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (4,8-dimethyl-2-oxochromen-7-yl) dihydrogen phosphate |
| SMILES | Cc1cc(=O)oc2c(C)c(OP(=O)(O)O)ccc12 |
| InChI | InChI=1S/C11H11O6P/c1-6-5-10(12)16-11-7(2)9(4-3-8(6)11)17-18(13,14)15/h3-5H,1-2H3,(H2,13,14,15) |
| InChIKey | NPGYIJZABGBAKR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|