C17H18O4 — CID 907360
4,8-dimethyl-7-[(1R)-2-oxocyclohexyl]oxychromen-2-one (PubChem CID 907360) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4,8-dimethyl-7-[(1R)-2-oxocyclohexyl]oxychromen-2-one.
| Compound Name | 4,8-dimethyl-7-[(1R)-2-oxocyclohexyl]oxychromen-2-one |
|---|---|
| PubChem CID | 907360 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4,8-dimethyl-7-[(1R)-2-oxocyclohexyl]oxychromen-2-one |
| SMILES | Cc1cc(=O)oc2c(C)c(O[C@@H]3CCCCC3=O)ccc12 |
| InChI | InChI=1S/C17H18O4/c1-10-9-16(19)21-17-11(2)14(8-7-12(10)17)20-15-6-4-3-5-13(15)18/h7-9,15H,3-6H2,1-2H3/t15-/m1/s1 |
| InChIKey | WRTZCCCOMNOONZ-OAHLLOKOSA-N |
| XLogP | 3.30 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|